C33H52ClNO2 — CID 168997231
5-chloro-3-pentyl-3-propyl-1H-indol-2-one;ethane;1-(1-methylcyclopropyl)-4-propoxybenzene (PubChem CID 168997231) has the molecular formula C33H52ClNO2 and a molecular weight of 530.24 g/mol. Its IUPAC name is 5-chloro-3-pentyl-3-propyl-1H-indol-2-one;ethane;1-(1-methylcyclopropyl)-4-propoxybenzene.
| Compound Name | 5-chloro-3-pentyl-3-propyl-1H-indol-2-one;ethane;1-(1-methylcyclopropyl)-4-propoxybenzene |
|---|---|
| PubChem CID | 168997231 |
| Molecular Formula | C33H52ClNO2 |
| Molecular Weight | 530.24 g/mol |
| Exact Mass | 529.37 |
| IUPAC Name | 5-chloro-3-pentyl-3-propyl-1H-indol-2-one;ethane;1-(1-methylcyclopropyl)-4-propoxybenzene |
| SMILES | CC.CC.CCCCCC1(CCC)C(=O)Nc2ccc(Cl)cc21.CCCOc1ccc(C2(C)CC2)cc1 |
| InChI | InChI=1S/C16H22ClNO.C13H18O.2C2H6/c1-3-5-6-10-16(9-4-2)13-11-12(17)7-8-14(13)18-15(16)19;1-3-10-14-12-6-4-11(5-7-12)13(2)8-9-13;2*1-2/h7-8,11H,3-6,9-10H2,1-2H3,(H,18,19);4-7H,3,8-10H2,1-2H3;2*1-2H3 |
| InChIKey | BRGVPCKIXDAWQH-UHFFFAOYSA-N |
| XLogP | 10.49 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.24 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|