C24H24F2N6O2 — CID 168998689
2-(difluoromethyl)-7-[3-(6-methoxy-3-pyridinyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]-8,9-dimethyl-6,7-dihydropyrimido[1,2-b]pyridazin-4-one (PubChem CID 168998689) has the molecular formula C24H24F2N6O2 and a molecular weight of 466.49 g/mol. Its IUPAC name is 2-(difluoromethyl)-7-[3-(6-methoxy-3-pyridinyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]-8,9-dimethyl-6,7-dihydropyrimido[1,2-b]pyridazin-4-one.
| Compound Name | 2-(difluoromethyl)-7-[3-(6-methoxy-3-pyridinyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]-8,9-dimethyl-6,7-dihydropyrimido[1,2-b]pyridazin-4-one |
|---|---|
| PubChem CID | 168998689 |
| Molecular Formula | C24H24F2N6O2 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 2-(difluoromethyl)-7-[3-(6-methoxy-3-pyridinyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]-8,9-dimethyl-6,7-dihydropyrimido[1,2-b]pyridazin-4-one |
| SMILES | COc1ccc(-c2cnc3c(c2)CN(C2Nn4c(nc(C(F)F)cc4=O)C(C)=C2C)CC3)cn1 |
| InChI | InChI=1S/C24H24F2N6O2/c1-13-14(2)24(30-32-21(33)9-19(22(25)26)29-23(13)32)31-7-6-18-17(12-31)8-16(11-27-18)15-4-5-20(34-3)28-10-15/h4-5,8-11,22,24,30H,6-7,12H2,1-3H3 |
| InChIKey | WJWNLYFQXFLEKW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |