C28H34FN5O2 — CID 168998696
7-[3-[(4E,6E)-7-fluoro-2,5-dimethylocta-2,4,6-trien-4-yl]-7,8-dihydro-5H-1,6-naphthyridin-6-yl]-2-(methoxymethyl)-8-methyl-6,7-dihydropyrimido[1,2-b]pyridazin-4-one (PubChem CID 168998696) has the molecular formula C28H34FN5O2 and a molecular weight of 491.61 g/mol. Its IUPAC name is 7-[3-[(4E,6E)-7-fluoro-2,5-dimethylocta-2,4,6-trien-4-yl]-7,8-dihydro-5H-1,6-naphthyridin-6-yl]-2-(methoxymethyl)-8-methyl-6,7-dihydropyrimido[1,2-b]pyridazin-4-one.
| Compound Name | 7-[3-[(4E,6E)-7-fluoro-2,5-dimethylocta-2,4,6-trien-4-yl]-7,8-dihydro-5H-1,6-naphthyridin-6-yl]-2-(methoxymethyl)-8-methyl-6,7-dihydropyrimido[1,2-b]pyridazin-4-one |
|---|---|
| PubChem CID | 168998696 |
| Molecular Formula | C28H34FN5O2 |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.27 |
| IUPAC Name | 7-[3-[(4E,6E)-7-fluoro-2,5-dimethylocta-2,4,6-trien-4-yl]-7,8-dihydro-5H-1,6-naphthyridin-6-yl]-2-(methoxymethyl)-8-methyl-6,7-dihydropyrimido[1,2-b]pyridazin-4-one |
| SMILES | COCc1cc(=O)n2c(n1)C=C(C)C(N1CCc3ncc(/C(C=C(C)C)=C(C)/C=C(\C)F)cc3C1)N2 |
| InChI | InChI=1S/C28H34FN5O2/c1-17(2)9-24(18(3)10-20(5)29)21-12-22-15-33(8-7-25(22)30-14-21)28-19(4)11-26-31-23(16-36-6)13-27(35)34(26)32-28/h9-14,28,32H,7-8,15-16H2,1-6H3/b20-10+,24-18+ |
| InChIKey | PEDXHEIOMOIGMR-YUWVQUFNSA-N |
| XLogP | 4.74 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|