About ethane;(E)-3-ethylsulfanyl-N,2-dimethylprop-2-en-1-amine;prop-1-yne
ethane;(E)-3-ethylsulfanyl-N,2-dimethylprop-2-en-1-amine;prop-1-yne (PubChem CID 168998835) has the molecular formula C12H25NS
and a molecular weight of 215.41 g/mol. Its IUPAC name is ethane;(E)-3-ethylsulfanyl-N,2-dimethylprop-2-en-1-amine;prop-1-yne.
Molecular Properties
| Compound Name | ethane;(E)-3-ethylsulfanyl-N,2-dimethylprop-2-en-1-amine;prop-1-yne |
| PubChem CID | 168998835 |
| Molecular Formula | C12H25NS |
| Molecular Weight | 215.41 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | ethane;(E)-3-ethylsulfanyl-N,2-dimethylprop-2-en-1-amine;prop-1-yne |
| SMILES | C#CC.CC.CCS/C=C(\C)CNC |
| InChI | InChI=1S/C7H15NS.C3H4.C2H6/c1-4-9-6-7(2)5-8-3;1-3-2;1-2/h6,8H,4-5H2,1-3H3;1H,2H3;1-2H3/b7-6+;; |
| InChIKey | TXCBJTKOJNELEI-KMXZHCNGSA-N |
| XLogP | 3.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.41 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;(E)-3-ethylsulfanyl-N,2-dimethylprop-2-en-1-amine;prop-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(E)-3-ethylsulfanyl-N,2-dimethylprop-2-en-1-amine;prop-1-yne?
The IUPAC name of ethane;(E)-3-ethylsulfanyl-N,2-dimethylprop-2-en-1-amine;prop-1-yne (CID 168998835) is ethane;(E)-3-ethylsulfanyl-N,2-dimethylprop-2-en-1-amine;prop-1-yne.
What is the SMILES notation for ethane;(E)-3-ethylsulfanyl-N,2-dimethylprop-2-en-1-amine;prop-1-yne?
The canonical SMILES for ethane;(E)-3-ethylsulfanyl-N,2-dimethylprop-2-en-1-amine;prop-1-yne is C#CC.CC.CCS/C=C(\C)CNC.
What is the InChIKey of ethane;(E)-3-ethylsulfanyl-N,2-dimethylprop-2-en-1-amine;prop-1-yne?
The InChIKey is TXCBJTKOJNELEI-KMXZHCNGSA-N. The full InChI is InChI=1S/C7H15NS.C3H4.C2H6/c1-4-9-6-7(2)5-8-3;1-3-2;1-2/h6,8H,4-5H2,1-3H3;1H,2H3;1-2H3/b7-6+;;.
What are the key properties of ethane;(E)-3-ethylsulfanyl-N,2-dimethylprop-2-en-1-amine;prop-1-yne?
ethane;(E)-3-ethylsulfanyl-N,2-dimethylprop-2-en-1-amine;prop-1-yne has a molecular weight of 215.41 g/mol, XLogP of 3.53, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(E)-3-ethylsulfanyl-N,2-dimethylprop-2-en-1-amine;prop-1-yne is sourced from PubChem (CID 168998835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).