C14H20N2O — CID 168998954
3-methyl-2-[(1Z,3E)-2,3,4-trimethylhexa-1,3-dienyl]pyrimidin-4-one (PubChem CID 168998954) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 3-methyl-2-[(1Z,3E)-2,3,4-trimethylhexa-1,3-dienyl]pyrimidin-4-one.
| Compound Name | 3-methyl-2-[(1Z,3E)-2,3,4-trimethylhexa-1,3-dienyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 168998954 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 3-methyl-2-[(1Z,3E)-2,3,4-trimethylhexa-1,3-dienyl]pyrimidin-4-one |
| SMILES | CC/C(C)=C(C)/C(C)=C\c1nccc(=O)n1C |
| InChI | InChI=1S/C14H20N2O/c1-6-10(2)12(4)11(3)9-13-15-8-7-14(17)16(13)5/h7-9H,6H2,1-5H3/b11-9-,12-10+ |
| InChIKey | HIQGIVDRNWCETN-DSOJMZEYSA-N |
| XLogP | 2.93 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|