C24H31N7O — CID 168999008
7-[3-[(Z)-1-amino-3-propyliminoprop-1-en-2-yl]-7,8-dihydro-5H-1,6-naphthyridin-6-yl]-2,8,9-trimethyl-6,7-dihydropyrimido[1,2-b]pyridazin-4-one (PubChem CID 168999008) has the molecular formula C24H31N7O and a molecular weight of 433.56 g/mol. Its IUPAC name is 7-[3-[(Z)-1-amino-3-propyliminoprop-1-en-2-yl]-7,8-dihydro-5H-1,6-naphthyridin-6-yl]-2,8,9-trimethyl-6,7-dihydropyrimido[1,2-b]pyridazin-4-one.
| Compound Name | 7-[3-[(Z)-1-amino-3-propyliminoprop-1-en-2-yl]-7,8-dihydro-5H-1,6-naphthyridin-6-yl]-2,8,9-trimethyl-6,7-dihydropyrimido[1,2-b]pyridazin-4-one |
|---|---|
| PubChem CID | 168999008 |
| Molecular Formula | C24H31N7O |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | 7-[3-[(Z)-1-amino-3-propyliminoprop-1-en-2-yl]-7,8-dihydro-5H-1,6-naphthyridin-6-yl]-2,8,9-trimethyl-6,7-dihydropyrimido[1,2-b]pyridazin-4-one |
| SMILES | CCC/N=C/C(=C\N)c1cnc2c(c1)CN(C1Nn3c(nc(C)cc3=O)C(C)=C1C)CC2 |
| InChI | InChI=1S/C24H31N7O/c1-5-7-26-12-20(11-25)18-10-19-14-30(8-6-21(19)27-13-18)24-17(4)16(3)23-28-15(2)9-22(32)31(23)29-24/h9-13,24,29H,5-8,14,25H2,1-4H3/b20-11+,26-12+ |
| InChIKey | VLGVCRIIDPBCMC-XDLRHYLFSA-N |
| XLogP | 2.46 |
| TPSA | 101.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|