About 4-ethylpyridazine;N-[(E)-2-methylbut-1-enyl]prop-2-en-1-imine
4-ethylpyridazine;N-[(E)-2-methylbut-1-enyl]prop-2-en-1-imine (PubChem CID 168999291) has the molecular formula C14H21N3
and a molecular weight of 231.34 g/mol. Its IUPAC name is 4-ethylpyridazine;N-[(E)-2-methylbut-1-enyl]prop-2-en-1-imine.
Molecular Properties
| Compound Name | 4-ethylpyridazine;N-[(E)-2-methylbut-1-enyl]prop-2-en-1-imine |
| PubChem CID | 168999291 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | 4-ethylpyridazine;N-[(E)-2-methylbut-1-enyl]prop-2-en-1-imine |
| SMILES | C=C/C=N/C=C(\C)CC.CCc1ccnnc1 |
| InChI | InChI=1S/C8H13N.C6H8N2/c1-4-6-9-7-8(3)5-2;1-2-6-3-4-7-8-5-6/h4,6-7H,1,5H2,2-3H3;3-5H,2H2,1H3/b8-7+,9-6+; |
| InChIKey | QYJGKEPENMOSIX-CFIVAETHSA-N |
| XLogP | 3.60 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-ethylpyridazine;N-[(E)-2-methylbut-1-enyl]prop-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylpyridazine;N-[(E)-2-methylbut-1-enyl]prop-2-en-1-imine?
The IUPAC name of 4-ethylpyridazine;N-[(E)-2-methylbut-1-enyl]prop-2-en-1-imine (CID 168999291) is 4-ethylpyridazine;N-[(E)-2-methylbut-1-enyl]prop-2-en-1-imine.
What is the SMILES notation for 4-ethylpyridazine;N-[(E)-2-methylbut-1-enyl]prop-2-en-1-imine?
The canonical SMILES for 4-ethylpyridazine;N-[(E)-2-methylbut-1-enyl]prop-2-en-1-imine is C=C/C=N/C=C(\C)CC.CCc1ccnnc1.
What is the InChIKey of 4-ethylpyridazine;N-[(E)-2-methylbut-1-enyl]prop-2-en-1-imine?
The InChIKey is QYJGKEPENMOSIX-CFIVAETHSA-N. The full InChI is InChI=1S/C8H13N.C6H8N2/c1-4-6-9-7-8(3)5-2;1-2-6-3-4-7-8-5-6/h4,6-7H,1,5H2,2-3H3;3-5H,2H2,1H3/b8-7+,9-6+;.
What are the key properties of 4-ethylpyridazine;N-[(E)-2-methylbut-1-enyl]prop-2-en-1-imine?
4-ethylpyridazine;N-[(E)-2-methylbut-1-enyl]prop-2-en-1-imine has a molecular weight of 231.34 g/mol, XLogP of 3.60, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylpyridazine;N-[(E)-2-methylbut-1-enyl]prop-2-en-1-imine is sourced from PubChem (CID 168999291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).