C55H69N8O9Si — CID 169000153
CID 169000153 (PubChem CID 169000153) has the molecular formula C55H69N8O9Si and a molecular weight of 1014.29 g/mol.
| Compound Name | CID 169000153 |
|---|---|
| PubChem CID | 169000153 |
| Molecular Formula | C55H69N8O9Si |
| Molecular Weight | 1014.29 g/mol |
| Exact Mass | 1013.50 |
| IUPAC Name | — |
| SMILES | COCOc1cc2c3c(cccc3c1)C(C)c1c-2ncc2c(N3CC4CCC(C3)N4C(=O)OC(C)(C)C)nc(OC[C@@]34CCCN3[C@]([Si])(CN3CCC(COc5cc(C(C(=O)O)C(C)C)on5)CC3)CC4)nc12 |
| InChI | InChI=1S/C55H69N8O9Si/c1-32(2)44(50(64)65)42-24-43(59-72-42)68-28-34-14-20-60(21-15-34)29-55(73)18-17-54(16-9-19-62(54)55)30-69-51-57-48-41(49(58-51)61-26-36-12-13-37(27-61)63(36)52(66)71-53(4,5)6)25-56-47-40-23-38(70-31-67-7)22-35-10-8-11-39(46(35)40)33(3)45(47)48/h8,10-11,22-25,32-34,36-37,44H,9,12-21,26-31H2,1-7H3,(H,64,65)/t33?,36?,37?,44?,54-,55+/m0/s1 |
| InChIKey | QEYZQHHWTMQQEW-BVJVPLIKSA-N |
| XLogP | 8.36 |
| TPSA | 178.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 73 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1014.29 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|