C13H6F4N2O — CID 169001743
N-(3,4-difluorophenyl)-5,6-difluoro-1,3-benzoxazol-2-amine (PubChem CID 169001743) has the molecular formula C13H6F4N2O and a molecular weight of 282.20 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-5,6-difluoro-1,3-benzoxazol-2-amine.
| Compound Name | N-(3,4-difluorophenyl)-5,6-difluoro-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 169001743 |
| Molecular Formula | C13H6F4N2O |
| Molecular Weight | 282.20 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | N-(3,4-difluorophenyl)-5,6-difluoro-1,3-benzoxazol-2-amine |
| SMILES | Fc1ccc(Nc2nc3cc(F)c(F)cc3o2)cc1F |
| InChI | InChI=1S/C13H6F4N2O/c14-7-2-1-6(3-8(7)15)18-13-19-11-4-9(16)10(17)5-12(11)20-13/h1-5H,(H,18,19) |
| InChIKey | LYIOLPNMRZVZOU-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.20 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |