About 6-(pyrazolo[1,5-a]pyridin-7-ylmethyl)-2-azaspiro[3.3]heptane-2-carbaldehyde
6-(pyrazolo[1,5-a]pyridin-7-ylmethyl)-2-azaspiro[3.3]heptane-2-carbaldehyde (PubChem CID 169002380) has the molecular formula C15H17N3O
and a molecular weight of 255.32 g/mol. Its IUPAC name is 6-(pyrazolo[1,5-a]pyridin-7-ylmethyl)-2-azaspiro[3.3]heptane-2-carbaldehyde.
Molecular Properties
| Compound Name | 6-(pyrazolo[1,5-a]pyridin-7-ylmethyl)-2-azaspiro[3.3]heptane-2-carbaldehyde |
| PubChem CID | 169002380 |
| Molecular Formula | C15H17N3O |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 6-(pyrazolo[1,5-a]pyridin-7-ylmethyl)-2-azaspiro[3.3]heptane-2-carbaldehyde |
| SMILES | O=CN1CC2(CC(Cc3cccc4ccnn34)C2)C1 |
| InChI | InChI=1S/C15H17N3O/c19-11-17-9-15(10-17)7-12(8-15)6-14-3-1-2-13-4-5-16-18(13)14/h1-5,11-12H,6-10H2 |
| InChIKey | MHUFHOTVYXGSIL-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-(pyrazolo[1,5-a]pyridin-7-ylmethyl)-2-azaspiro[3.3]heptane-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(pyrazolo[1,5-a]pyridin-7-ylmethyl)-2-azaspiro[3.3]heptane-2-carbaldehyde?
The IUPAC name of 6-(pyrazolo[1,5-a]pyridin-7-ylmethyl)-2-azaspiro[3.3]heptane-2-carbaldehyde (CID 169002380) is 6-(pyrazolo[1,5-a]pyridin-7-ylmethyl)-2-azaspiro[3.3]heptane-2-carbaldehyde.
What is the SMILES notation for 6-(pyrazolo[1,5-a]pyridin-7-ylmethyl)-2-azaspiro[3.3]heptane-2-carbaldehyde?
The canonical SMILES for 6-(pyrazolo[1,5-a]pyridin-7-ylmethyl)-2-azaspiro[3.3]heptane-2-carbaldehyde is O=CN1CC2(CC(Cc3cccc4ccnn34)C2)C1.
What is the InChIKey of 6-(pyrazolo[1,5-a]pyridin-7-ylmethyl)-2-azaspiro[3.3]heptane-2-carbaldehyde?
The InChIKey is MHUFHOTVYXGSIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3O/c19-11-17-9-15(10-17)7-12(8-15)6-14-3-1-2-13-4-5-16-18(13)14/h1-5,11-12H,6-10H2.
What are the key properties of 6-(pyrazolo[1,5-a]pyridin-7-ylmethyl)-2-azaspiro[3.3]heptane-2-carbaldehyde?
6-(pyrazolo[1,5-a]pyridin-7-ylmethyl)-2-azaspiro[3.3]heptane-2-carbaldehyde has a molecular weight of 255.32 g/mol, XLogP of 1.75, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(pyrazolo[1,5-a]pyridin-7-ylmethyl)-2-azaspiro[3.3]heptane-2-carbaldehyde is sourced from PubChem (CID 169002380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).