C14H15F3N2O — CID 169002396
6-[6-(trifluoromethyl)-2-pyridinyl]-2-azaspiro[3.4]octane-2-carbaldehyde (PubChem CID 169002396) has the molecular formula C14H15F3N2O and a molecular weight of 284.28 g/mol. Its IUPAC name is 6-[6-(trifluoromethyl)-2-pyridinyl]-2-azaspiro[3.4]octane-2-carbaldehyde.
| Compound Name | 6-[6-(trifluoromethyl)-2-pyridinyl]-2-azaspiro[3.4]octane-2-carbaldehyde |
|---|---|
| PubChem CID | 169002396 |
| Molecular Formula | C14H15F3N2O |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 6-[6-(trifluoromethyl)-2-pyridinyl]-2-azaspiro[3.4]octane-2-carbaldehyde |
| SMILES | O=CN1CC2(CCC(c3cccc(C(F)(F)F)n3)C2)C1 |
| InChI | InChI=1S/C14H15F3N2O/c15-14(16,17)12-3-1-2-11(18-12)10-4-5-13(6-10)7-19(8-13)9-20/h1-3,9-10H,4-8H2 |
| InChIKey | ZCPXYUCHETUPCG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|