C48H54N8O10S3 — CID 169002556
bis(N-[4-[4-(cyclopropylmethyl)piperazin-4-ium-1-carbonyl]phenyl]quinoline-8-sulfonamide);sulfate (PubChem CID 169002556) has the molecular formula C48H54N8O10S3 and a molecular weight of 999.21 g/mol. Its IUPAC name is bis(N-[4-[4-(cyclopropylmethyl)piperazin-4-ium-1-carbonyl]phenyl]quinoline-8-sulfonamide);sulfate.
| Compound Name | bis(N-[4-[4-(cyclopropylmethyl)piperazin-4-ium-1-carbonyl]phenyl]quinoline-8-sulfonamide);sulfate |
|---|---|
| PubChem CID | 169002556 |
| Molecular Formula | C48H54N8O10S3 |
| Molecular Weight | 999.21 g/mol |
| Exact Mass | 998.31 |
| IUPAC Name | bis(N-[4-[4-(cyclopropylmethyl)piperazin-4-ium-1-carbonyl]phenyl]quinoline-8-sulfonamide);sulfate |
| SMILES | O=C(c1ccc(NS(=O)(=O)c2cccc3cccnc23)cc1)N1CC[NH+](CC2CC2)CC1.O=C(c1ccc(NS(=O)(=O)c2cccc3cccnc23)cc1)N1CC[NH+](CC2CC2)CC1.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/2C24H26N4O3S.H2O4S/c2*29-24(28-15-13-27(14-16-28)17-18-6-7-18)20-8-10-21(11-9-20)26-32(30,31)22-5-1-3-19-4-2-12-25-23(19)22;1-5(2,3)4/h2*1-5,8-12,18,26H,6-7,13-17H2;(H2,1,2,3,4) |
| InChIKey | XNNUNDNGUZFBHS-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 247.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 999.21 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|