About 2-oxopyrrolo[2,3-b]pyridine-5-carboxamide
2-oxopyrrolo[2,3-b]pyridine-5-carboxamide (PubChem CID 169002980) has the molecular formula C8H5N3O2
and a molecular weight of 175.15 g/mol. Its IUPAC name is 2-oxopyrrolo[2,3-b]pyridine-5-carboxamide.
Molecular Properties
| Compound Name | 2-oxopyrrolo[2,3-b]pyridine-5-carboxamide |
| PubChem CID | 169002980 |
| Molecular Formula | C8H5N3O2 |
| Molecular Weight | 175.15 g/mol |
| Exact Mass | 175.04 |
| IUPAC Name | 2-oxopyrrolo[2,3-b]pyridine-5-carboxamide |
| SMILES | NC(=O)c1cnc2c(c1)=CC(=O)N=2 |
| InChI | InChI=1S/C8H5N3O2/c9-7(13)5-1-4-2-6(12)11-8(4)10-3-5/h1-3H,(H2,9,13) |
| InChIKey | MRMUZAOQGRBVGW-UHFFFAOYSA-N |
| XLogP | -1.88 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.15 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-oxopyrrolo[2,3-b]pyridine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxopyrrolo[2,3-b]pyridine-5-carboxamide?
The IUPAC name of 2-oxopyrrolo[2,3-b]pyridine-5-carboxamide (CID 169002980) is 2-oxopyrrolo[2,3-b]pyridine-5-carboxamide.
What is the SMILES notation for 2-oxopyrrolo[2,3-b]pyridine-5-carboxamide?
The canonical SMILES for 2-oxopyrrolo[2,3-b]pyridine-5-carboxamide is NC(=O)c1cnc2c(c1)=CC(=O)N=2.
What is the InChIKey of 2-oxopyrrolo[2,3-b]pyridine-5-carboxamide?
The InChIKey is MRMUZAOQGRBVGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N3O2/c9-7(13)5-1-4-2-6(12)11-8(4)10-3-5/h1-3H,(H2,9,13).
What are the key properties of 2-oxopyrrolo[2,3-b]pyridine-5-carboxamide?
2-oxopyrrolo[2,3-b]pyridine-5-carboxamide has a molecular weight of 175.15 g/mol, XLogP of -1.88, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxopyrrolo[2,3-b]pyridine-5-carboxamide is sourced from PubChem (CID 169002980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).