C30H28Cl2N6O3S — CID 169003588
methyl 2-(3-aminoprop-1-ynyl)-4-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]amino]benzoate;hydrochloride (PubChem CID 169003588) has the molecular formula C30H28Cl2N6O3S and a molecular weight of 623.57 g/mol. Its IUPAC name is methyl 2-(3-aminoprop-1-ynyl)-4-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]amino]benzoate;hydrochloride.
| Compound Name | methyl 2-(3-aminoprop-1-ynyl)-4-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]amino]benzoate;hydrochloride |
|---|---|
| PubChem CID | 169003588 |
| Molecular Formula | C30H28Cl2N6O3S |
| Molecular Weight | 623.57 g/mol |
| Exact Mass | 622.13 |
| IUPAC Name | methyl 2-(3-aminoprop-1-ynyl)-4-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]amino]benzoate;hydrochloride |
| SMILES | COC(=O)c1ccc(NC(=O)C[C@@H]2N=C(c3ccc(Cl)cc3)c3c(sc(C)c3C)-n3c(C)nnc32)cc1C#CCN.Cl |
| InChI | InChI=1S/C30H27ClN6O3S.ClH/c1-16-17(2)41-29-26(16)27(19-7-9-21(31)10-8-19)34-24(28-36-35-18(3)37(28)29)15-25(38)33-22-11-12-23(30(39)40-4)20(14-22)6-5-13-32;/h7-12,14,24H,13,15,32H2,1-4H3,(H,33,38);1H/t24-;/m0./s1 |
| InChIKey | PNRGZIPORQZGRW-JIDHJSLPSA-N |
| XLogP | 5.35 |
| TPSA | 124.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.57 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|