C29H37ClN6O3S — CID 169003648
10-amino-2-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]amino]decanoic acid (PubChem CID 169003648) has the molecular formula C29H37ClN6O3S and a molecular weight of 585.17 g/mol. Its IUPAC name is 10-amino-2-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]amino]decanoic acid.
| Compound Name | 10-amino-2-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]amino]decanoic acid |
|---|---|
| PubChem CID | 169003648 |
| Molecular Formula | C29H37ClN6O3S |
| Molecular Weight | 585.17 g/mol |
| Exact Mass | 584.23 |
| IUPAC Name | 10-amino-2-[[2-[(9S)-7-(4-chlorophenyl)-4,5,13-trimethyl-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaen-9-yl]acetyl]amino]decanoic acid |
| SMILES | Cc1sc2c(c1C)C(c1ccc(Cl)cc1)=N[C@@H](CC(=O)NC(CCCCCCCCN)C(=O)O)c1nnc(C)n1-2 |
| InChI | InChI=1S/C29H37ClN6O3S/c1-17-18(2)40-28-25(17)26(20-11-13-21(30)14-12-20)33-23(27-35-34-19(3)36(27)28)16-24(37)32-22(29(38)39)10-8-6-4-5-7-9-15-31/h11-14,22-23H,4-10,15-16,31H2,1-3H3,(H,32,37)(H,38,39)/t22?,23-/m0/s1 |
| InChIKey | VJTOAJFYAOKBCP-WCSIJFPASA-N |
| XLogP | 5.45 |
| TPSA | 135.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.17 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|