About 1H-pyrrolo[3,2-b]pyridin-5-ylthiourea
1H-pyrrolo[3,2-b]pyridin-5-ylthiourea (PubChem CID 169004095) has the molecular formula C8H8N4S
and a molecular weight of 192.25 g/mol. Its IUPAC name is 1H-pyrrolo[3,2-b]pyridin-5-ylthiourea.
Molecular Properties
| Compound Name | 1H-pyrrolo[3,2-b]pyridin-5-ylthiourea |
| PubChem CID | 169004095 |
| Molecular Formula | C8H8N4S |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 1H-pyrrolo[3,2-b]pyridin-5-ylthiourea |
| SMILES | NC(=S)Nc1ccc2[nH]ccc2n1 |
| InChI | InChI=1S/C8H8N4S/c9-8(13)12-7-2-1-5-6(11-7)3-4-10-5/h1-4,10H,(H3,9,11,12,13) |
| InChIKey | FIRKENZBWSIYHG-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1H-pyrrolo[3,2-b]pyridin-5-ylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrrolo[3,2-b]pyridin-5-ylthiourea?
The IUPAC name of 1H-pyrrolo[3,2-b]pyridin-5-ylthiourea (CID 169004095) is 1H-pyrrolo[3,2-b]pyridin-5-ylthiourea.
What is the SMILES notation for 1H-pyrrolo[3,2-b]pyridin-5-ylthiourea?
The canonical SMILES for 1H-pyrrolo[3,2-b]pyridin-5-ylthiourea is NC(=S)Nc1ccc2[nH]ccc2n1.
What is the InChIKey of 1H-pyrrolo[3,2-b]pyridin-5-ylthiourea?
The InChIKey is FIRKENZBWSIYHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4S/c9-8(13)12-7-2-1-5-6(11-7)3-4-10-5/h1-4,10H,(H3,9,11,12,13).
What are the key properties of 1H-pyrrolo[3,2-b]pyridin-5-ylthiourea?
1H-pyrrolo[3,2-b]pyridin-5-ylthiourea has a molecular weight of 192.25 g/mol, XLogP of 1.22, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrrolo[3,2-b]pyridin-5-ylthiourea is sourced from PubChem (CID 169004095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).