C22H23N5O4S2 — CID 169004641
[(3S,4R,5R)-4-acetyloxy-5-[2-hex-1-ynyl-8-(1,3-thiazol-2-yl)purin-9-yl]thiolan-3-yl] acetate (PubChem CID 169004641) has the molecular formula C22H23N5O4S2 and a molecular weight of 485.59 g/mol. Its IUPAC name is [(3S,4R,5R)-4-acetyloxy-5-[2-hex-1-ynyl-8-(1,3-thiazol-2-yl)purin-9-yl]thiolan-3-yl] acetate.
| Compound Name | [(3S,4R,5R)-4-acetyloxy-5-[2-hex-1-ynyl-8-(1,3-thiazol-2-yl)purin-9-yl]thiolan-3-yl] acetate |
|---|---|
| PubChem CID | 169004641 |
| Molecular Formula | C22H23N5O4S2 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | [(3S,4R,5R)-4-acetyloxy-5-[2-hex-1-ynyl-8-(1,3-thiazol-2-yl)purin-9-yl]thiolan-3-yl] acetate |
| SMILES | CCCCC#Cc1ncc2nc(-c3nccs3)n([C@@H]3SC[C@@H](OC(C)=O)[C@H]3OC(C)=O)c2n1 |
| InChI | InChI=1S/C22H23N5O4S2/c1-4-5-6-7-8-17-24-11-15-19(26-17)27(20(25-15)21-23-9-10-32-21)22-18(31-14(3)29)16(12-33-22)30-13(2)28/h9-11,16,18,22H,4-6,12H2,1-3H3/t16-,18-,22-/m1/s1 |
| InChIKey | OAKDWVAZYJPYNT-RADWXHQJSA-N |
| XLogP | 3.60 |
| TPSA | 109.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|