C17H20N4S2 — CID 169004864
1-[(5,5-dimethyl-1,4-dihydroimidazol-2-yl)sulfanylmethyl]-5,10-dihydro-[1,3]thiazolo[3,2-b][2,4]benzodiazepine (PubChem CID 169004864) has the molecular formula C17H20N4S2 and a molecular weight of 344.51 g/mol. Its IUPAC name is 1-[(5,5-dimethyl-1,4-dihydroimidazol-2-yl)sulfanylmethyl]-5,10-dihydro-[1,3]thiazolo[3,2-b][2,4]benzodiazepine.
| Compound Name | 1-[(5,5-dimethyl-1,4-dihydroimidazol-2-yl)sulfanylmethyl]-5,10-dihydro-[1,3]thiazolo[3,2-b][2,4]benzodiazepine |
|---|---|
| PubChem CID | 169004864 |
| Molecular Formula | C17H20N4S2 |
| Molecular Weight | 344.51 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 1-[(5,5-dimethyl-1,4-dihydroimidazol-2-yl)sulfanylmethyl]-5,10-dihydro-[1,3]thiazolo[3,2-b][2,4]benzodiazepine |
| SMILES | CC1(C)CN=C(SCC2=CSC3=NCc4ccccc4CN23)N1 |
| InChI | InChI=1S/C17H20N4S2/c1-17(2)11-19-15(20-17)22-9-14-10-23-16-18-7-12-5-3-4-6-13(12)8-21(14)16/h3-6,10H,7-9,11H2,1-2H3,(H,19,20) |
| InChIKey | UWCBAYXSGQSADF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.51 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |