About 3-(3-pyrrolidin-1-ylpropylsulfanyl)-2,5-dihydro-1H-2,4-benzodiazepine;dihydrochloride
3-(3-pyrrolidin-1-ylpropylsulfanyl)-2,5-dihydro-1H-2,4-benzodiazepine;dihydrochloride (PubChem CID 169005030) has the molecular formula C16H25Cl2N3S
and a molecular weight of 362.37 g/mol. Its IUPAC name is 3-(3-pyrrolidin-1-ylpropylsulfanyl)-2,5-dihydro-1H-2,4-benzodiazepine;dihydrochloride.
Molecular Properties
| Compound Name | 3-(3-pyrrolidin-1-ylpropylsulfanyl)-2,5-dihydro-1H-2,4-benzodiazepine;dihydrochloride |
| PubChem CID | 169005030 |
| Molecular Formula | C16H25Cl2N3S |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 3-(3-pyrrolidin-1-ylpropylsulfanyl)-2,5-dihydro-1H-2,4-benzodiazepine;dihydrochloride |
| SMILES | Cl.Cl.c1ccc2c(c1)CN=C(SCCCN1CCCC1)NC2 |
| InChI | InChI=1S/C16H23N3S.2ClH/c1-2-7-15-13-18-16(17-12-14(15)6-1)20-11-5-10-19-8-3-4-9-19;;/h1-2,6-7H,3-5,8-13H2,(H,17,18);2*1H |
| InChIKey | AOFOFBDDVYAJEJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-pyrrolidin-1-ylpropylsulfanyl)-2,5-dihydro-1H-2,4-benzodiazepine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-pyrrolidin-1-ylpropylsulfanyl)-2,5-dihydro-1H-2,4-benzodiazepine;dihydrochloride?
The IUPAC name of 3-(3-pyrrolidin-1-ylpropylsulfanyl)-2,5-dihydro-1H-2,4-benzodiazepine;dihydrochloride (CID 169005030) is 3-(3-pyrrolidin-1-ylpropylsulfanyl)-2,5-dihydro-1H-2,4-benzodiazepine;dihydrochloride.
What is the SMILES notation for 3-(3-pyrrolidin-1-ylpropylsulfanyl)-2,5-dihydro-1H-2,4-benzodiazepine;dihydrochloride?
The canonical SMILES for 3-(3-pyrrolidin-1-ylpropylsulfanyl)-2,5-dihydro-1H-2,4-benzodiazepine;dihydrochloride is Cl.Cl.c1ccc2c(c1)CN=C(SCCCN1CCCC1)NC2.
What is the InChIKey of 3-(3-pyrrolidin-1-ylpropylsulfanyl)-2,5-dihydro-1H-2,4-benzodiazepine;dihydrochloride?
The InChIKey is AOFOFBDDVYAJEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N3S.2ClH/c1-2-7-15-13-18-16(17-12-14(15)6-1)20-11-5-10-19-8-3-4-9-19;;/h1-2,6-7H,3-5,8-13H2,(H,17,18);2*1H.
What are the key properties of 3-(3-pyrrolidin-1-ylpropylsulfanyl)-2,5-dihydro-1H-2,4-benzodiazepine;dihydrochloride?
3-(3-pyrrolidin-1-ylpropylsulfanyl)-2,5-dihydro-1H-2,4-benzodiazepine;dihydrochloride has a molecular weight of 362.37 g/mol, XLogP of 3.71, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-pyrrolidin-1-ylpropylsulfanyl)-2,5-dihydro-1H-2,4-benzodiazepine;dihydrochloride is sourced from PubChem (CID 169005030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).