C21H21ClN2OS2 — CID 16900551
2-[2-[(3-chlorophenyl)methylsulfanyl]-1,3-thiazol-4-yl]-N-(3-phenylpropyl)acetamide (PubChem CID 16900551) has the molecular formula C21H21ClN2OS2 and a molecular weight of 417.00 g/mol. Its IUPAC name is 2-[2-[(3-chlorophenyl)methylsulfanyl]-1,3-thiazol-4-yl]-N-(3-phenylpropyl)acetamide.
| Compound Name | 2-[2-[(3-chlorophenyl)methylsulfanyl]-1,3-thiazol-4-yl]-N-(3-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 16900551 |
| Molecular Formula | C21H21ClN2OS2 |
| Molecular Weight | 417.00 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | 2-[2-[(3-chlorophenyl)methylsulfanyl]-1,3-thiazol-4-yl]-N-(3-phenylpropyl)acetamide |
| SMILES | O=C(Cc1csc(SCc2cccc(Cl)c2)n1)NCCCc1ccccc1 |
| InChI | InChI=1S/C21H21ClN2OS2/c22-18-10-4-8-17(12-18)14-26-21-24-19(15-27-21)13-20(25)23-11-5-9-16-6-2-1-3-7-16/h1-4,6-8,10,12,15H,5,9,11,13-14H2,(H,23,25) |
| InChIKey | RZMZKSBXCRXWOP-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.00 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|