C28H29Cl2N5O6 — CID 169005579
(2R,3R,4S,5R,6R)-N-(3-chloro-5-cyanophenyl)-4-[4-(4-chlorophenyl)triazol-1-yl]-5-hydroxy-N-[(1R,2R)-2-hydroxycyclopentyl]-6-(hydroxymethyl)-3-methoxyoxane-2-carboxamide (PubChem CID 169005579) has the molecular formula C28H29Cl2N5O6 and a molecular weight of 602.48 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-N-(3-chloro-5-cyanophenyl)-4-[4-(4-chlorophenyl)triazol-1-yl]-5-hydroxy-N-[(1R,2R)-2-hydroxycyclopentyl]-6-(hydroxymethyl)-3-methoxyoxane-2-carboxamide.
| Compound Name | (2R,3R,4S,5R,6R)-N-(3-chloro-5-cyanophenyl)-4-[4-(4-chlorophenyl)triazol-1-yl]-5-hydroxy-N-[(1R,2R)-2-hydroxycyclopentyl]-6-(hydroxymethyl)-3-methoxyoxane-2-carboxamide |
|---|---|
| PubChem CID | 169005579 |
| Molecular Formula | C28H29Cl2N5O6 |
| Molecular Weight | 602.48 g/mol |
| Exact Mass | 601.15 |
| IUPAC Name | (2R,3R,4S,5R,6R)-N-(3-chloro-5-cyanophenyl)-4-[4-(4-chlorophenyl)triazol-1-yl]-5-hydroxy-N-[(1R,2R)-2-hydroxycyclopentyl]-6-(hydroxymethyl)-3-methoxyoxane-2-carboxamide |
| SMILES | CO[C@@H]1[C@@H](n2cc(-c3ccc(Cl)cc3)nn2)[C@@H](O)[C@@H](CO)O[C@H]1C(=O)N(c1cc(Cl)cc(C#N)c1)[C@@H]1CCC[C@H]1O |
| InChI | InChI=1S/C28H29Cl2N5O6/c1-40-26-24(34-13-20(32-33-34)16-5-7-17(29)8-6-16)25(38)23(14-36)41-27(26)28(39)35(21-3-2-4-22(21)37)19-10-15(12-31)9-18(30)11-19/h5-11,13,21-27,36-38H,2-4,14H2,1H3/t21-,22-,23-,24+,25+,26-,27-/m1/s1 |
| InChIKey | ANLRXALNQFGBGW-XYVQZSPKSA-N |
| XLogP | 2.75 |
| TPSA | 153.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.48 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |