About 2-[3,5-bis(3-cyclopropylpropyl)phenyl]ethanol
2-[3,5-bis(3-cyclopropylpropyl)phenyl]ethanol (PubChem CID 169005685) has the molecular formula C20H30O
and a molecular weight of 286.46 g/mol. Its IUPAC name is 2-[3,5-bis(3-cyclopropylpropyl)phenyl]ethanol.
Molecular Properties
| Compound Name | 2-[3,5-bis(3-cyclopropylpropyl)phenyl]ethanol |
| PubChem CID | 169005685 |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | 2-[3,5-bis(3-cyclopropylpropyl)phenyl]ethanol |
| SMILES | OCCc1cc(CCCC2CC2)cc(CCCC2CC2)c1 |
| InChI | InChI=1S/C20H30O/c21-12-11-20-14-18(5-1-3-16-7-8-16)13-19(15-20)6-2-4-17-9-10-17/h13-17,21H,1-12H2 |
| InChIKey | ZYIKBJCHWOVDRY-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[3,5-bis(3-cyclopropylpropyl)phenyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,5-bis(3-cyclopropylpropyl)phenyl]ethanol?
The IUPAC name of 2-[3,5-bis(3-cyclopropylpropyl)phenyl]ethanol (CID 169005685) is 2-[3,5-bis(3-cyclopropylpropyl)phenyl]ethanol.
What is the SMILES notation for 2-[3,5-bis(3-cyclopropylpropyl)phenyl]ethanol?
The canonical SMILES for 2-[3,5-bis(3-cyclopropylpropyl)phenyl]ethanol is OCCc1cc(CCCC2CC2)cc(CCCC2CC2)c1.
What is the InChIKey of 2-[3,5-bis(3-cyclopropylpropyl)phenyl]ethanol?
The InChIKey is ZYIKBJCHWOVDRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30O/c21-12-11-20-14-18(5-1-3-16-7-8-16)13-19(15-20)6-2-4-17-9-10-17/h13-17,21H,1-12H2.
What are the key properties of 2-[3,5-bis(3-cyclopropylpropyl)phenyl]ethanol?
2-[3,5-bis(3-cyclopropylpropyl)phenyl]ethanol has a molecular weight of 286.46 g/mol, XLogP of 4.69, 10 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5-bis(3-cyclopropylpropyl)phenyl]ethanol is sourced from PubChem (CID 169005685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).