About 8-iodospiro[4.5]decane-1,4-dione
8-iodospiro[4.5]decane-1,4-dione (PubChem CID 169006620) has the molecular formula C10H13IO2
and a molecular weight of 292.12 g/mol. Its IUPAC name is 8-iodospiro[4.5]decane-1,4-dione.
Molecular Properties
| Compound Name | 8-iodospiro[4.5]decane-1,4-dione |
| PubChem CID | 169006620 |
| Molecular Formula | C10H13IO2 |
| Molecular Weight | 292.12 g/mol |
| Exact Mass | 292.00 |
| IUPAC Name | 8-iodospiro[4.5]decane-1,4-dione |
| SMILES | O=C1CCC(=O)C12CCC(I)CC2 |
| InChI | InChI=1S/C10H13IO2/c11-7-3-5-10(6-4-7)8(12)1-2-9(10)13/h7H,1-6H2 |
| InChIKey | MQZLDKORKBKVAB-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.12 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 8-iodospiro[4.5]decane-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-iodospiro[4.5]decane-1,4-dione?
The IUPAC name of 8-iodospiro[4.5]decane-1,4-dione (CID 169006620) is 8-iodospiro[4.5]decane-1,4-dione.
What is the SMILES notation for 8-iodospiro[4.5]decane-1,4-dione?
The canonical SMILES for 8-iodospiro[4.5]decane-1,4-dione is O=C1CCC(=O)C12CCC(I)CC2.
What is the InChIKey of 8-iodospiro[4.5]decane-1,4-dione?
The InChIKey is MQZLDKORKBKVAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13IO2/c11-7-3-5-10(6-4-7)8(12)1-2-9(10)13/h7H,1-6H2.
What are the key properties of 8-iodospiro[4.5]decane-1,4-dione?
8-iodospiro[4.5]decane-1,4-dione has a molecular weight of 292.12 g/mol, XLogP of 2.28, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-iodospiro[4.5]decane-1,4-dione is sourced from PubChem (CID 169006620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).