About bis(3,3-bis(4-prop-2-enoxyphenyl)indol-1-id-2-one);tungsten(2+)
bis(3,3-bis(4-prop-2-enoxyphenyl)indol-1-id-2-one);tungsten(2+) (PubChem CID 169008055) has the molecular formula C52H44N2O6W
and a molecular weight of 976.77 g/mol. Its IUPAC name is bis(3,3-bis(4-prop-2-enoxyphenyl)indol-1-id-2-one);tungsten(2+).
Molecular Properties
| Compound Name | bis(3,3-bis(4-prop-2-enoxyphenyl)indol-1-id-2-one);tungsten(2+) |
| PubChem CID | 169008055 |
| Molecular Formula | C52H44N2O6W |
| Molecular Weight | 976.77 g/mol |
| Exact Mass | 976.27 |
| IUPAC Name | bis(3,3-bis(4-prop-2-enoxyphenyl)indol-1-id-2-one);tungsten(2+) |
| SMILES | C=CCOc1ccc(C2(c3ccc(OCC=C)cc3)C(=O)[N-]c3ccccc32)cc1.C=CCOc1ccc(C2(c3ccc(OCC=C)cc3)C(=O)[N-]c3ccccc32)cc1.[W+2] |
| InChI | InChI=1S/2C26H23NO3.W/c2*1-3-17-29-21-13-9-19(10-14-21)26(20-11-15-22(16-12-20)30-18-4-2)23-7-5-6-8-24(23)27-25(26)28;/h2*3-16H,1-2,17-18H2,(H,27,28);/q;;+2/p-2 |
| InChIKey | GFEPBOPEQCWRBS-UHFFFAOYSA-L |
| XLogP | 11.39 |
| TPSA | 99.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 61 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 976.77 |
| LogP ≤ 5 | 11.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bis(3,3-bis(4-prop-2-enoxyphenyl)indol-1-id-2-one);tungsten(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3,3-bis(4-prop-2-enoxyphenyl)indol-1-id-2-one);tungsten(2+)?
The IUPAC name of bis(3,3-bis(4-prop-2-enoxyphenyl)indol-1-id-2-one);tungsten(2+) (CID 169008055) is bis(3,3-bis(4-prop-2-enoxyphenyl)indol-1-id-2-one);tungsten(2+).
What is the SMILES notation for bis(3,3-bis(4-prop-2-enoxyphenyl)indol-1-id-2-one);tungsten(2+)?
The canonical SMILES for bis(3,3-bis(4-prop-2-enoxyphenyl)indol-1-id-2-one);tungsten(2+) is C=CCOc1ccc(C2(c3ccc(OCC=C)cc3)C(=O)[N-]c3ccccc32)cc1.C=CCOc1ccc(C2(c3ccc(OCC=C)cc3)C(=O)[N-]c3ccccc32)cc1.[W+2].
What is the InChIKey of bis(3,3-bis(4-prop-2-enoxyphenyl)indol-1-id-2-one);tungsten(2+)?
The InChIKey is GFEPBOPEQCWRBS-UHFFFAOYSA-L. The full InChI is InChI=1S/2C26H23NO3.W/c2*1-3-17-29-21-13-9-19(10-14-21)26(20-11-15-22(16-12-20)30-18-4-2)23-7-5-6-8-24(23)27-25(26)28;/h2*3-16H,1-2,17-18H2,(H,27,28);/q;;+2/p-2.
What are the key properties of bis(3,3-bis(4-prop-2-enoxyphenyl)indol-1-id-2-one);tungsten(2+)?
bis(3,3-bis(4-prop-2-enoxyphenyl)indol-1-id-2-one);tungsten(2+) has a molecular weight of 976.77 g/mol, XLogP of 11.39, 16 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3,3-bis(4-prop-2-enoxyphenyl)indol-1-id-2-one);tungsten(2+) is sourced from PubChem (CID 169008055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).