About 1,1-dideuterioethyl methanesulfonate
1,1-dideuterioethyl methanesulfonate (PubChem CID 169008398) has the molecular formula C3H8O3S
and a molecular weight of 126.17 g/mol. Its IUPAC name is 1,1-dideuterioethyl methanesulfonate.
Molecular Properties
| Compound Name | 1,1-dideuterioethyl methanesulfonate |
| PubChem CID | 169008398 |
| Molecular Formula | C3H8O3S |
| Molecular Weight | 126.17 g/mol |
| Exact Mass | 126.03 |
| IUPAC Name | 1,1-dideuterioethyl methanesulfonate |
| SMILES | [2H]C([2H])(C)OS(C)(=O)=O |
| InChI | InChI=1S/C3H8O3S/c1-3-6-7(2,4)5/h3H2,1-2H3/i3D2 |
| InChIKey | PLUBXMRUUVWRLT-SMZGMGDZSA-N |
| XLogP | -0.02 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.17 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dideuterioethyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dideuterioethyl methanesulfonate?
The IUPAC name of 1,1-dideuterioethyl methanesulfonate (CID 169008398) is 1,1-dideuterioethyl methanesulfonate.
What is the SMILES notation for 1,1-dideuterioethyl methanesulfonate?
The canonical SMILES for 1,1-dideuterioethyl methanesulfonate is [2H]C([2H])(C)OS(C)(=O)=O.
What is the InChIKey of 1,1-dideuterioethyl methanesulfonate?
The InChIKey is PLUBXMRUUVWRLT-SMZGMGDZSA-N. The full InChI is InChI=1S/C3H8O3S/c1-3-6-7(2,4)5/h3H2,1-2H3/i3D2.
What are the key properties of 1,1-dideuterioethyl methanesulfonate?
1,1-dideuterioethyl methanesulfonate has a molecular weight of 126.17 g/mol, XLogP of -0.02, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dideuterioethyl methanesulfonate is sourced from PubChem (CID 169008398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).