C23H20F4N6 — CID 169008747
N-(azetidin-3-yl)-6-[1-fluoro-7-(2,2,2-trifluoroethyl)-2,8,9,10-tetrahydrocyclohepta[e]indazol-6-yl]-5-isocyanopyridin-3-amine (PubChem CID 169008747) has the molecular formula C23H20F4N6 and a molecular weight of 456.45 g/mol. Its IUPAC name is N-(azetidin-3-yl)-6-[1-fluoro-7-(2,2,2-trifluoroethyl)-2,8,9,10-tetrahydrocyclohepta[e]indazol-6-yl]-5-isocyanopyridin-3-amine.
| Compound Name | N-(azetidin-3-yl)-6-[1-fluoro-7-(2,2,2-trifluoroethyl)-2,8,9,10-tetrahydrocyclohepta[e]indazol-6-yl]-5-isocyanopyridin-3-amine |
|---|---|
| PubChem CID | 169008747 |
| Molecular Formula | C23H20F4N6 |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | N-(azetidin-3-yl)-6-[1-fluoro-7-(2,2,2-trifluoroethyl)-2,8,9,10-tetrahydrocyclohepta[e]indazol-6-yl]-5-isocyanopyridin-3-amine |
| SMILES | [C-]#[N+]c1cc(NC2CNC2)cnc1C1=C(CC(F)(F)F)CCCc2c1ccc1n[nH]c(F)c21 |
| InChI | InChI=1S/C23H20F4N6/c1-28-18-7-13(31-14-9-29-10-14)11-30-21(18)19-12(8-23(25,26)27)3-2-4-15-16(19)5-6-17-20(15)22(24)33-32-17/h5-7,11,14,29,31H,2-4,8-10H2,(H,32,33) |
| InChIKey | PWEBJDCSJURKII-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 69.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|