C16H14F12O2 — CID 169008825
4,4-dimethyl-1-[2,3,5-trifluoro-4,6-bis(trifluoromethyl)phenyl]-2-(trifluoromethyl)pentane-1,3-diol (PubChem CID 169008825) has the molecular formula C16H14F12O2 and a molecular weight of 466.26 g/mol. Its IUPAC name is 4,4-dimethyl-1-[2,3,5-trifluoro-4,6-bis(trifluoromethyl)phenyl]-2-(trifluoromethyl)pentane-1,3-diol.
| Compound Name | 4,4-dimethyl-1-[2,3,5-trifluoro-4,6-bis(trifluoromethyl)phenyl]-2-(trifluoromethyl)pentane-1,3-diol |
|---|---|
| PubChem CID | 169008825 |
| Molecular Formula | C16H14F12O2 |
| Molecular Weight | 466.26 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | 4,4-dimethyl-1-[2,3,5-trifluoro-4,6-bis(trifluoromethyl)phenyl]-2-(trifluoromethyl)pentane-1,3-diol |
| SMILES | CC(C)(C)C(O)C(C(O)c1c(F)c(F)c(C(F)(F)F)c(F)c1C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H14F12O2/c1-13(2,3)12(30)7(16(26,27)28)11(29)4-5(14(20,21)22)9(18)6(15(23,24)25)10(19)8(4)17/h7,11-12,29-30H,1-3H3 |
| InChIKey | MCIQAZKFQCIPSS-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.26 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|