C12H15FeNO2 — CID 169008870
4-(2,4-dihydroxypentan-3-yl)benzonitrile;iron (PubChem CID 169008870) has the molecular formula C12H15FeNO2 and a molecular weight of 261.10 g/mol. Its IUPAC name is 4-(2,4-dihydroxypentan-3-yl)benzonitrile;iron.
| Compound Name | 4-(2,4-dihydroxypentan-3-yl)benzonitrile;iron |
|---|---|
| PubChem CID | 169008870 |
| Molecular Formula | C12H15FeNO2 |
| Molecular Weight | 261.10 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | 4-(2,4-dihydroxypentan-3-yl)benzonitrile;iron |
| SMILES | CC(O)C(c1ccc(C#N)cc1)C(C)O.[Fe] |
| InChI | InChI=1S/C12H15NO2.Fe/c1-8(14)12(9(2)15)11-5-3-10(7-13)4-6-11;/h3-6,8-9,12,14-15H,1-2H3; |
| InChIKey | IJUIIRAIEHLDOP-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.10 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|