C8H11F2N3O2 — CID 169008931
3-(4,6-difluoro-1,3,5-triazin-2-yl)pentane-2,4-diol (PubChem CID 169008931) has the molecular formula C8H11F2N3O2 and a molecular weight of 219.19 g/mol. Its IUPAC name is 3-(4,6-difluoro-1,3,5-triazin-2-yl)pentane-2,4-diol.
| Compound Name | 3-(4,6-difluoro-1,3,5-triazin-2-yl)pentane-2,4-diol |
|---|---|
| PubChem CID | 169008931 |
| Molecular Formula | C8H11F2N3O2 |
| Molecular Weight | 219.19 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 3-(4,6-difluoro-1,3,5-triazin-2-yl)pentane-2,4-diol |
| SMILES | CC(O)C(c1nc(F)nc(F)n1)C(C)O |
| InChI | InChI=1S/C8H11F2N3O2/c1-3(14)5(4(2)15)6-11-7(9)13-8(10)12-6/h3-5,14-15H,1-2H3 |
| InChIKey | GXRCAZJPMFIVSE-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 79.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.19 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |