C11H8BrFO — CID 169009484
3-bromo-5-fluoro-1-methyl-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene (PubChem CID 169009484) has the molecular formula C11H8BrFO and a molecular weight of 255.09 g/mol. Its IUPAC name is 3-bromo-5-fluoro-1-methyl-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene.
| Compound Name | 3-bromo-5-fluoro-1-methyl-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene |
|---|---|
| PubChem CID | 169009484 |
| Molecular Formula | C11H8BrFO |
| Molecular Weight | 255.09 g/mol |
| Exact Mass | 253.97 |
| IUPAC Name | 3-bromo-5-fluoro-1-methyl-11-oxatricyclo[6.2.1.02,7]undeca-2(7),3,5,9-tetraene |
| SMILES | CC12C=CC(O1)c1cc(F)cc(Br)c12 |
| InChI | InChI=1S/C11H8BrFO/c1-11-3-2-9(14-11)7-4-6(13)5-8(12)10(7)11/h2-5,9H,1H3 |
| InChIKey | IYBCHORXGOVHNX-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.09 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|