C12H20FNO2 — CID 169009488
(6R,8S)-8-(butoxymethyl)-6-fluoro-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one (PubChem CID 169009488) has the molecular formula C12H20FNO2 and a molecular weight of 229.29 g/mol. Its IUPAC name is (6R,8S)-8-(butoxymethyl)-6-fluoro-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one.
| Compound Name | (6R,8S)-8-(butoxymethyl)-6-fluoro-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one |
|---|---|
| PubChem CID | 169009488 |
| Molecular Formula | C12H20FNO2 |
| Molecular Weight | 229.29 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | (6R,8S)-8-(butoxymethyl)-6-fluoro-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one |
| SMILES | CCCCOC[C@@]12CCC(=O)N1C[C@H](F)C2 |
| InChI | InChI=1S/C12H20FNO2/c1-2-3-6-16-9-12-5-4-11(15)14(12)8-10(13)7-12/h10H,2-9H2,1H3/t10-,12+/m1/s1 |
| InChIKey | TUQBVJWXOKDQQD-PWSUYJOCSA-N |
| XLogP | 1.91 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.29 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|