C7H8FO7P — CID 169009530
4-fluoro-5-[(E)-2-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]ethenyl]-1,3-dioxolan-2-one (PubChem CID 169009530) has the molecular formula C7H8FO7P and a molecular weight of 254.11 g/mol. Its IUPAC name is 4-fluoro-5-[(E)-2-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]ethenyl]-1,3-dioxolan-2-one.
| Compound Name | 4-fluoro-5-[(E)-2-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]ethenyl]-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 169009530 |
| Molecular Formula | C7H8FO7P |
| Molecular Weight | 254.11 g/mol |
| Exact Mass | 254.00 |
| IUPAC Name | 4-fluoro-5-[(E)-2-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]ethenyl]-1,3-dioxolan-2-one |
| SMILES | O=C1OC(F)C(/C=C/OP2(=O)OCCO2)O1 |
| InChI | InChI=1S/C7H8FO7P/c8-6-5(14-7(9)15-6)1-2-11-16(10)12-3-4-13-16/h1-2,5-6H,3-4H2/b2-1+ |
| InChIKey | VIGRXHIPOCIWSX-OWOJBTEDSA-N |
| XLogP | 1.50 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.11 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|