C5H9O8PS — CID 169009532
5-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]-1,3,2-dioxathiane 2,2-dioxide (PubChem CID 169009532) has the molecular formula C5H9O8PS and a molecular weight of 260.16 g/mol. Its IUPAC name is 5-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]-1,3,2-dioxathiane 2,2-dioxide.
| Compound Name | 5-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]-1,3,2-dioxathiane 2,2-dioxide |
|---|---|
| PubChem CID | 169009532 |
| Molecular Formula | C5H9O8PS |
| Molecular Weight | 260.16 g/mol |
| Exact Mass | 259.98 |
| IUPAC Name | 5-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]-1,3,2-dioxathiane 2,2-dioxide |
| SMILES | O=P1(OC2COS(=O)(=O)OC2)OCCO1 |
| InChI | InChI=1S/C5H9O8PS/c6-14(9-1-2-10-14)13-5-3-11-15(7,8)12-4-5/h5H,1-4H2 |
| InChIKey | MKOGPYZKYFQOEA-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.16 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|