C7H11O7P — CID 169009553
2-[(4-ethenyl-1,3-dioxolan-2-yl)peroxy]-1,3,2λ5-dioxaphospholane 2-oxide (PubChem CID 169009553) has the molecular formula C7H11O7P and a molecular weight of 238.13 g/mol. Its IUPAC name is 2-[(4-ethenyl-1,3-dioxolan-2-yl)peroxy]-1,3,2λ5-dioxaphospholane 2-oxide.
| Compound Name | 2-[(4-ethenyl-1,3-dioxolan-2-yl)peroxy]-1,3,2λ5-dioxaphospholane 2-oxide |
|---|---|
| PubChem CID | 169009553 |
| Molecular Formula | C7H11O7P |
| Molecular Weight | 238.13 g/mol |
| Exact Mass | 238.02 |
| IUPAC Name | 2-[(4-ethenyl-1,3-dioxolan-2-yl)peroxy]-1,3,2λ5-dioxaphospholane 2-oxide |
| SMILES | C=CC1COC(OOP2(=O)OCCO2)O1 |
| InChI | InChI=1S/C7H11O7P/c1-2-6-5-9-7(12-6)13-14-15(8)10-3-4-11-15/h2,6-7H,1,3-5H2 |
| InChIKey | ZKRLAOIOCWHPDY-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.13 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|