C7H9O7P — CID 169009571
4-ethenyl-5-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]-1,3-dioxolan-2-one (PubChem CID 169009571) has the molecular formula C7H9O7P and a molecular weight of 236.12 g/mol. Its IUPAC name is 4-ethenyl-5-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]-1,3-dioxolan-2-one.
| Compound Name | 4-ethenyl-5-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 169009571 |
| Molecular Formula | C7H9O7P |
| Molecular Weight | 236.12 g/mol |
| Exact Mass | 236.01 |
| IUPAC Name | 4-ethenyl-5-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]-1,3-dioxolan-2-one |
| SMILES | C=CC1OC(=O)OC1OP1(=O)OCCO1 |
| InChI | InChI=1S/C7H9O7P/c1-2-5-6(13-7(8)12-5)14-15(9)10-3-4-11-15/h2,5-6H,1,3-4H2 |
| InChIKey | UNHNZGJNCLAKCJ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.12 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|