C21H26N3O2+ — CID 169011671
dimethyl-[[[4-(methylamino)-9,10-dioxoanthracen-1-yl]amino]methyl]-propylazanium (PubChem CID 169011671) has the molecular formula C21H26N3O2+ and a molecular weight of 352.46 g/mol. Its IUPAC name is dimethyl-[[[4-(methylamino)-9,10-dioxoanthracen-1-yl]amino]methyl]-propylazanium.
| Compound Name | dimethyl-[[[4-(methylamino)-9,10-dioxoanthracen-1-yl]amino]methyl]-propylazanium |
|---|---|
| PubChem CID | 169011671 |
| Molecular Formula | C21H26N3O2+ |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | dimethyl-[[[4-(methylamino)-9,10-dioxoanthracen-1-yl]amino]methyl]-propylazanium |
| SMILES | CCC[N+](C)(C)CNc1ccc(NC)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C21H25N3O2/c1-5-12-24(3,4)13-23-17-11-10-16(22-2)18-19(17)21(26)15-9-7-6-8-14(15)20(18)25/h6-11H,5,12-13H2,1-4H3,(H-,22,23,25,26)/p+1 |
| InChIKey | HUMQBEHUKSROLQ-UHFFFAOYSA-O |
| XLogP | 3.36 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|