C48H32N2 — CID 169011944
1,2,3,4,5,7,8-heptadeuterio-6-[5-(2,3,4,5,6-pentadeuteriophenyl)-9-phenylcarbazol-3-yl]-9-(4-phenylphenyl)carbazole (PubChem CID 169011944) has the molecular formula C48H32N2 and a molecular weight of 648.87 g/mol. Its IUPAC name is 1,2,3,4,5,7,8-heptadeuterio-6-[5-(2,3,4,5,6-pentadeuteriophenyl)-9-phenylcarbazol-3-yl]-9-(4-phenylphenyl)carbazole.
| Compound Name | 1,2,3,4,5,7,8-heptadeuterio-6-[5-(2,3,4,5,6-pentadeuteriophenyl)-9-phenylcarbazol-3-yl]-9-(4-phenylphenyl)carbazole |
|---|---|
| PubChem CID | 169011944 |
| Molecular Formula | C48H32N2 |
| Molecular Weight | 648.87 g/mol |
| Exact Mass | 648.33 |
| IUPAC Name | 1,2,3,4,5,7,8-heptadeuterio-6-[5-(2,3,4,5,6-pentadeuteriophenyl)-9-phenylcarbazol-3-yl]-9-(4-phenylphenyl)carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cccc3c2c2cc(-c4c([2H])c([2H])c5c(c4[2H])c4c([2H])c([2H])c([2H])c([2H])c4n5-c4ccc(-c5ccccc5)cc4)ccc2n3-c2ccccc2)c([2H])c1[2H] |
| InChI | InChI=1S/C48H32N2/c1-4-13-33(14-5-1)34-23-27-39(28-24-34)49-44-21-11-10-19-41(44)42-31-36(25-29-45(42)49)37-26-30-46-43(32-37)48-40(35-15-6-2-7-16-35)20-12-22-47(48)50(46)38-17-8-3-9-18-38/h1-32H/i2D,6D,7D,10D,11D,15D,16D,19D,21D,25D,29D,31D |
| InChIKey | HCRHQKCXXCAQGJ-DXEJGFQFSA-N |
| XLogP | 12.88 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.87 |
| LogP ≤ 5 | 12.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |