C18H20FS+ — CID 169012938
cyclohexa-1,5-dien-1-yl-cyclohexa-2,4-dien-1-yl-(4-fluorocyclohexa-1,3-dien-1-yl)sulfanium (PubChem CID 169012938) has the molecular formula C18H20FS+ and a molecular weight of 287.42 g/mol. Its IUPAC name is cyclohexa-1,5-dien-1-yl-cyclohexa-2,4-dien-1-yl-(4-fluorocyclohexa-1,3-dien-1-yl)sulfanium.
| Compound Name | cyclohexa-1,5-dien-1-yl-cyclohexa-2,4-dien-1-yl-(4-fluorocyclohexa-1,3-dien-1-yl)sulfanium |
|---|---|
| PubChem CID | 169012938 |
| Molecular Formula | C18H20FS+ |
| Molecular Weight | 287.42 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | cyclohexa-1,5-dien-1-yl-cyclohexa-2,4-dien-1-yl-(4-fluorocyclohexa-1,3-dien-1-yl)sulfanium |
| SMILES | FC1=CC=C([S+](C2=CCCC=C2)C2C=CC=CC2)CC1 |
| InChI | InChI=1S/C18H20FS/c19-15-11-13-18(14-12-15)20(16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1,3-5,7,9-11,13,16H,2,6,8,12,14H2/q+1 |
| InChIKey | UOYFZTRGISFDNA-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.42 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|