C15H14ClO2PS — CID 169013341
(2S,4R,6R)-2-chloro-4,6-diphenyl-1,3,2λ5-oxathiaphosphinane 2-oxide (PubChem CID 169013341) has the molecular formula C15H14ClO2PS and a molecular weight of 324.77 g/mol. Its IUPAC name is (2S,4R,6R)-2-chloro-4,6-diphenyl-1,3,2λ5-oxathiaphosphinane 2-oxide.
| Compound Name | (2S,4R,6R)-2-chloro-4,6-diphenyl-1,3,2λ5-oxathiaphosphinane 2-oxide |
|---|---|
| PubChem CID | 169013341 |
| Molecular Formula | C15H14ClO2PS |
| Molecular Weight | 324.77 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | (2S,4R,6R)-2-chloro-4,6-diphenyl-1,3,2λ5-oxathiaphosphinane 2-oxide |
| SMILES | O=[P@]1(Cl)O[C@@H](c2ccccc2)C[C@H](c2ccccc2)S1 |
| InChI | InChI=1S/C15H14ClO2PS/c16-19(17)18-14(12-7-3-1-4-8-12)11-15(20-19)13-9-5-2-6-10-13/h1-10,14-15H,11H2/t14-,15-,19-/m1/s1 |
| InChIKey | ILNHTFFPVOCFKG-SPYBWZPUSA-N |
| XLogP | 5.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.77 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|