C13H12N8O2S — CID 169013678
3-[(2-methylpyrazol-3-yl)diazenyl]-5-[(3-methyl-1,2,4-thiadiazol-5-yl)diazenyl]benzene-1,2-diol (PubChem CID 169013678) has the molecular formula C13H12N8O2S and a molecular weight of 344.36 g/mol. Its IUPAC name is 3-[(2-methylpyrazol-3-yl)diazenyl]-5-[(3-methyl-1,2,4-thiadiazol-5-yl)diazenyl]benzene-1,2-diol.
| Compound Name | 3-[(2-methylpyrazol-3-yl)diazenyl]-5-[(3-methyl-1,2,4-thiadiazol-5-yl)diazenyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 169013678 |
| Molecular Formula | C13H12N8O2S |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 3-[(2-methylpyrazol-3-yl)diazenyl]-5-[(3-methyl-1,2,4-thiadiazol-5-yl)diazenyl]benzene-1,2-diol |
| SMILES | Cc1nsc(/N=N/c2cc(O)c(O)c(/N=N/c3ccnn3C)c2)n1 |
| InChI | InChI=1S/C13H12N8O2S/c1-7-15-13(24-20-7)19-16-8-5-9(12(23)10(22)6-8)17-18-11-3-4-14-21(11)2/h3-6,22-23H,1-2H3/b18-17+,19-16+ |
| InChIKey | QESYISXOJCDFBQ-KEGYOGFESA-N |
| XLogP | 3.82 |
| TPSA | 133.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|