About 2-(2,1-benzothiazol-3-yldiazenyl)-5-[(2-methylpyrazol-3-yl)diazenyl]benzene-1,4-diol
2-(2,1-benzothiazol-3-yldiazenyl)-5-[(2-methylpyrazol-3-yl)diazenyl]benzene-1,4-diol (PubChem CID 169013692) has the molecular formula C17H13N7O2S
and a molecular weight of 379.41 g/mol. Its IUPAC name is 2-(2,1-benzothiazol-3-yldiazenyl)-5-[(2-methylpyrazol-3-yl)diazenyl]benzene-1,4-diol.
Molecular Properties
| Compound Name | 2-(2,1-benzothiazol-3-yldiazenyl)-5-[(2-methylpyrazol-3-yl)diazenyl]benzene-1,4-diol |
| PubChem CID | 169013692 |
| Molecular Formula | C17H13N7O2S |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 2-(2,1-benzothiazol-3-yldiazenyl)-5-[(2-methylpyrazol-3-yl)diazenyl]benzene-1,4-diol |
| SMILES | Cn1nccc1/N=N/c1cc(O)c(/N=N/c2snc3ccccc23)cc1O |
| InChI | InChI=1S/C17H13N7O2S/c1-24-16(6-7-18-24)21-19-12-8-15(26)13(9-14(12)25)20-22-17-10-4-2-3-5-11(10)23-27-17/h2-9,25-26H,1H3/b21-19+,22-20+ |
| InChIKey | BVIVQPLDOHXELM-FLFKKZLDSA-N |
| XLogP | 5.27 |
| TPSA | 120.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,1-benzothiazol-3-yldiazenyl)-5-[(2-methylpyrazol-3-yl)diazenyl]benzene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,1-benzothiazol-3-yldiazenyl)-5-[(2-methylpyrazol-3-yl)diazenyl]benzene-1,4-diol?
The IUPAC name of 2-(2,1-benzothiazol-3-yldiazenyl)-5-[(2-methylpyrazol-3-yl)diazenyl]benzene-1,4-diol (CID 169013692) is 2-(2,1-benzothiazol-3-yldiazenyl)-5-[(2-methylpyrazol-3-yl)diazenyl]benzene-1,4-diol.
What is the SMILES notation for 2-(2,1-benzothiazol-3-yldiazenyl)-5-[(2-methylpyrazol-3-yl)diazenyl]benzene-1,4-diol?
The canonical SMILES for 2-(2,1-benzothiazol-3-yldiazenyl)-5-[(2-methylpyrazol-3-yl)diazenyl]benzene-1,4-diol is Cn1nccc1/N=N/c1cc(O)c(/N=N/c2snc3ccccc23)cc1O.
What is the InChIKey of 2-(2,1-benzothiazol-3-yldiazenyl)-5-[(2-methylpyrazol-3-yl)diazenyl]benzene-1,4-diol?
The InChIKey is BVIVQPLDOHXELM-FLFKKZLDSA-N. The full InChI is InChI=1S/C17H13N7O2S/c1-24-16(6-7-18-24)21-19-12-8-15(26)13(9-14(12)25)20-22-17-10-4-2-3-5-11(10)23-27-17/h2-9,25-26H,1H3/b21-19+,22-20+.
What are the key properties of 2-(2,1-benzothiazol-3-yldiazenyl)-5-[(2-methylpyrazol-3-yl)diazenyl]benzene-1,4-diol?
2-(2,1-benzothiazol-3-yldiazenyl)-5-[(2-methylpyrazol-3-yl)diazenyl]benzene-1,4-diol has a molecular weight of 379.41 g/mol, XLogP of 5.27, 4 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,1-benzothiazol-3-yldiazenyl)-5-[(2-methylpyrazol-3-yl)diazenyl]benzene-1,4-diol is sourced from PubChem (CID 169013692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).