C15H13N9OS2 — CID 169013748
5-[[4-(dimethylamino)-2-hydroxy-3-(1,2,4-thiadiazol-5-yldiazenyl)phenyl]diazenyl]-3-methyl-1,2-thiazole-4-carbonitrile (PubChem CID 169013748) has the molecular formula C15H13N9OS2 and a molecular weight of 399.47 g/mol. Its IUPAC name is 5-[[4-(dimethylamino)-2-hydroxy-3-(1,2,4-thiadiazol-5-yldiazenyl)phenyl]diazenyl]-3-methyl-1,2-thiazole-4-carbonitrile.
| Compound Name | 5-[[4-(dimethylamino)-2-hydroxy-3-(1,2,4-thiadiazol-5-yldiazenyl)phenyl]diazenyl]-3-methyl-1,2-thiazole-4-carbonitrile |
|---|---|
| PubChem CID | 169013748 |
| Molecular Formula | C15H13N9OS2 |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | 5-[[4-(dimethylamino)-2-hydroxy-3-(1,2,4-thiadiazol-5-yldiazenyl)phenyl]diazenyl]-3-methyl-1,2-thiazole-4-carbonitrile |
| SMILES | Cc1nsc(/N=N/c2ccc(N(C)C)c(/N=N/c3ncns3)c2O)c1C#N |
| InChI | InChI=1S/C15H13N9OS2/c1-8-9(6-16)14(26-23-8)21-19-10-4-5-11(24(2)3)12(13(10)25)20-22-15-17-7-18-27-15/h4-5,7,25H,1-3H3/b21-19+,22-20+ |
| InChIKey | CIROWUCIVCNMMV-FLFKKZLDSA-N |
| XLogP | 4.78 |
| TPSA | 135.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|