C19H27NO3S — CID 169014004
benzyl (3R,4S)-3-[2-[dimethyl(methylidene)-λ6-sulfanylidene]acetyl]-4-ethylpyrrolidine-1-carboxylate (PubChem CID 169014004) has the molecular formula C19H27NO3S and a molecular weight of 349.50 g/mol. Its IUPAC name is benzyl (3R,4S)-3-[2-[dimethyl(methylidene)-λ6-sulfanylidene]acetyl]-4-ethylpyrrolidine-1-carboxylate.
| Compound Name | benzyl (3R,4S)-3-[2-[dimethyl(methylidene)-λ6-sulfanylidene]acetyl]-4-ethylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 169014004 |
| Molecular Formula | C19H27NO3S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | benzyl (3R,4S)-3-[2-[dimethyl(methylidene)-λ6-sulfanylidene]acetyl]-4-ethylpyrrolidine-1-carboxylate |
| SMILES | C=S(C)(C)=CC(=O)[C@H]1CN(C(=O)OCc2ccccc2)C[C@H]1CC |
| InChI | InChI=1S/C19H27NO3S/c1-5-16-11-20(12-17(16)18(21)14-24(2,3)4)19(22)23-13-15-9-7-6-8-10-15/h6-10,14,16-17H,2,5,11-13H2,1,3-4H3/t16-,17+/m1/s1 |
| InChIKey | YZSXOBWAAVKMIZ-SJORKVTESA-N |
| XLogP | 3.15 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|