C13H13F3IN3O3 — CID 169016650
tert-butyl 3-iodo-6-(2,2,2-trifluoroethoxy)pyrazolo[4,3-c]pyridine-1-carboxylate (PubChem CID 169016650) has the molecular formula C13H13F3IN3O3 and a molecular weight of 443.16 g/mol. Its IUPAC name is tert-butyl 3-iodo-6-(2,2,2-trifluoroethoxy)pyrazolo[4,3-c]pyridine-1-carboxylate.
| Compound Name | tert-butyl 3-iodo-6-(2,2,2-trifluoroethoxy)pyrazolo[4,3-c]pyridine-1-carboxylate |
|---|---|
| PubChem CID | 169016650 |
| Molecular Formula | C13H13F3IN3O3 |
| Molecular Weight | 443.16 g/mol |
| Exact Mass | 443.00 |
| IUPAC Name | tert-butyl 3-iodo-6-(2,2,2-trifluoroethoxy)pyrazolo[4,3-c]pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1nc(I)c2cnc(OCC(F)(F)F)cc21 |
| InChI | InChI=1S/C13H13F3IN3O3/c1-12(2,3)23-11(21)20-8-4-9(22-6-13(14,15)16)18-5-7(8)10(17)19-20/h4-5H,6H2,1-3H3 |
| InChIKey | BRUQXPMWRSLLEH-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.16 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|