About N-(3,3-difluorocyclobutyl)-2,2-dimethylpropane-1-sulfonamide
N-(3,3-difluorocyclobutyl)-2,2-dimethylpropane-1-sulfonamide (PubChem CID 169016747) has the molecular formula C9H17F2NO2S
and a molecular weight of 241.30 g/mol. Its IUPAC name is N-(3,3-difluorocyclobutyl)-2,2-dimethylpropane-1-sulfonamide.
Molecular Properties
| Compound Name | N-(3,3-difluorocyclobutyl)-2,2-dimethylpropane-1-sulfonamide |
| PubChem CID | 169016747 |
| Molecular Formula | C9H17F2NO2S |
| Molecular Weight | 241.30 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | N-(3,3-difluorocyclobutyl)-2,2-dimethylpropane-1-sulfonamide |
| SMILES | CC(C)(C)CS(=O)(=O)NC1CC(F)(F)C1 |
| InChI | InChI=1S/C9H17F2NO2S/c1-8(2,3)6-15(13,14)12-7-4-9(10,11)5-7/h7,12H,4-6H2,1-3H3 |
| InChIKey | PVRHYGTXUUABKU-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(3,3-difluorocyclobutyl)-2,2-dimethylpropane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,3-difluorocyclobutyl)-2,2-dimethylpropane-1-sulfonamide?
The IUPAC name of N-(3,3-difluorocyclobutyl)-2,2-dimethylpropane-1-sulfonamide (CID 169016747) is N-(3,3-difluorocyclobutyl)-2,2-dimethylpropane-1-sulfonamide.
What is the SMILES notation for N-(3,3-difluorocyclobutyl)-2,2-dimethylpropane-1-sulfonamide?
The canonical SMILES for N-(3,3-difluorocyclobutyl)-2,2-dimethylpropane-1-sulfonamide is CC(C)(C)CS(=O)(=O)NC1CC(F)(F)C1.
What is the InChIKey of N-(3,3-difluorocyclobutyl)-2,2-dimethylpropane-1-sulfonamide?
The InChIKey is PVRHYGTXUUABKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F2NO2S/c1-8(2,3)6-15(13,14)12-7-4-9(10,11)5-7/h7,12H,4-6H2,1-3H3.
What are the key properties of N-(3,3-difluorocyclobutyl)-2,2-dimethylpropane-1-sulfonamide?
N-(3,3-difluorocyclobutyl)-2,2-dimethylpropane-1-sulfonamide has a molecular weight of 241.30 g/mol, XLogP of 1.75, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,3-difluorocyclobutyl)-2,2-dimethylpropane-1-sulfonamide is sourced from PubChem (CID 169016747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).