C38H42Br2N2O2 — CID 169016928
4,7-bis[4-(6-bromohexoxy)phenyl]-2,9-dimethyl-1,10-phenanthroline (PubChem CID 169016928) has the molecular formula C38H42Br2N2O2 and a molecular weight of 718.57 g/mol. Its IUPAC name is 4,7-bis[4-(6-bromohexoxy)phenyl]-2,9-dimethyl-1,10-phenanthroline.
| Compound Name | 4,7-bis[4-(6-bromohexoxy)phenyl]-2,9-dimethyl-1,10-phenanthroline |
|---|---|
| PubChem CID | 169016928 |
| Molecular Formula | C38H42Br2N2O2 |
| Molecular Weight | 718.57 g/mol |
| Exact Mass | 716.16 |
| IUPAC Name | 4,7-bis[4-(6-bromohexoxy)phenyl]-2,9-dimethyl-1,10-phenanthroline |
| SMILES | Cc1cc(-c2ccc(OCCCCCCBr)cc2)c2ccc3c(-c4ccc(OCCCCCCBr)cc4)cc(C)nc3c2n1 |
| InChI | InChI=1S/C38H42Br2N2O2/c1-27-25-35(29-11-15-31(16-12-29)43-23-9-5-3-7-21-39)33-19-20-34-36(26-28(2)42-38(34)37(33)41-27)30-13-17-32(18-14-30)44-24-10-6-4-8-22-40/h11-20,25-26H,3-10,21-24H2,1-2H3 |
| InChIKey | RJWYJMVNWKBDHA-UHFFFAOYSA-N |
| XLogP | 11.40 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.57 |
| LogP ≤ 5 | 11.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|