C29H24F3O3S+ — CID 169017029
diphenyl-[4-[2-[4-(trifluoromethoxy)phenyl]propan-2-yloxycarbonyl]phenyl]sulfanium (PubChem CID 169017029) has the molecular formula C29H24F3O3S+ and a molecular weight of 509.57 g/mol. Its IUPAC name is diphenyl-[4-[2-[4-(trifluoromethoxy)phenyl]propan-2-yloxycarbonyl]phenyl]sulfanium.
| Compound Name | diphenyl-[4-[2-[4-(trifluoromethoxy)phenyl]propan-2-yloxycarbonyl]phenyl]sulfanium |
|---|---|
| PubChem CID | 169017029 |
| Molecular Formula | C29H24F3O3S+ |
| Molecular Weight | 509.57 g/mol |
| Exact Mass | 509.14 |
| IUPAC Name | diphenyl-[4-[2-[4-(trifluoromethoxy)phenyl]propan-2-yloxycarbonyl]phenyl]sulfanium |
| SMILES | CC(C)(OC(=O)c1ccc([S+](c2ccccc2)c2ccccc2)cc1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C29H24F3O3S/c1-28(2,22-15-17-23(18-16-22)34-29(30,31)32)35-27(33)21-13-19-26(20-14-21)36(24-9-5-3-6-10-24)25-11-7-4-8-12-25/h3-20H,1-2H3/q+1 |
| InChIKey | SUVLCQPICBYCSX-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.57 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|