C31H31F3N6O4 — CID 169018110
5-[2-[4-[[3-(1,3-oxazol-5-ylmethyl)-5-(trifluoromethoxy)phenyl]methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide (PubChem CID 169018110) has the molecular formula C31H31F3N6O4 and a molecular weight of 608.62 g/mol. Its IUPAC name is 5-[2-[4-[[3-(1,3-oxazol-5-ylmethyl)-5-(trifluoromethoxy)phenyl]methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide.
| Compound Name | 5-[2-[4-[[3-(1,3-oxazol-5-ylmethyl)-5-(trifluoromethoxy)phenyl]methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide |
|---|---|
| PubChem CID | 169018110 |
| Molecular Formula | C31H31F3N6O4 |
| Molecular Weight | 608.62 g/mol |
| Exact Mass | 608.24 |
| IUPAC Name | 5-[2-[4-[[3-(1,3-oxazol-5-ylmethyl)-5-(trifluoromethoxy)phenyl]methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)nc(NCCOCCCCNCc1cc(Cc3cnco3)cc(OC(F)(F)F)c1)c1ccncc12 |
| InChI | InChI=1S/C31H31F3N6O4/c32-31(33,34)44-23-12-20(13-24-17-38-19-43-24)11-21(14-23)16-36-6-1-2-9-42-10-8-39-30-26-5-7-37-18-27(26)25-4-3-22(29(35)41)15-28(25)40-30/h3-5,7,11-12,14-15,17-19,36H,1-2,6,8-10,13,16H2,(H2,35,41)(H,39,40) |
| InChIKey | MTIHHEYRFCWOGO-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 137.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.62 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|