C31H30F3N5O5 — CID 169018118
5-[2-[4-[[3-(1,3-oxazol-5-ylmethyl)-5-(trifluoromethoxy)phenyl]methylamino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxamide (PubChem CID 169018118) has the molecular formula C31H30F3N5O5 and a molecular weight of 609.61 g/mol. Its IUPAC name is 5-[2-[4-[[3-(1,3-oxazol-5-ylmethyl)-5-(trifluoromethoxy)phenyl]methylamino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxamide.
| Compound Name | 5-[2-[4-[[3-(1,3-oxazol-5-ylmethyl)-5-(trifluoromethoxy)phenyl]methylamino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxamide |
|---|---|
| PubChem CID | 169018118 |
| Molecular Formula | C31H30F3N5O5 |
| Molecular Weight | 609.61 g/mol |
| Exact Mass | 609.22 |
| IUPAC Name | 5-[2-[4-[[3-(1,3-oxazol-5-ylmethyl)-5-(trifluoromethoxy)phenyl]methylamino]butoxy]ethoxy]benzo[c][2,6]naphthyridine-8-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)nc(OCCOCCCCNCc1cc(Cc3cnco3)cc(OC(F)(F)F)c1)c1ccncc12 |
| InChI | InChI=1S/C31H30F3N5O5/c32-31(33,34)44-23-12-20(13-24-17-38-19-43-24)11-21(14-23)16-36-6-1-2-8-41-9-10-42-30-26-5-7-37-18-27(26)25-4-3-22(29(35)40)15-28(25)39-30/h3-5,7,11-12,14-15,17-19,36H,1-2,6,8-10,13,16H2,(H2,35,40) |
| InChIKey | AGRIQCAANNNWID-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 134.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.61 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|