C33H34ClN5O3 — CID 169018119
5-[2-[4-[[3-chloro-4-[2-(hydroxymethyl)phenyl]phenyl]methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide (PubChem CID 169018119) has the molecular formula C33H34ClN5O3 and a molecular weight of 584.12 g/mol. Its IUPAC name is 5-[2-[4-[[3-chloro-4-[2-(hydroxymethyl)phenyl]phenyl]methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide.
| Compound Name | 5-[2-[4-[[3-chloro-4-[2-(hydroxymethyl)phenyl]phenyl]methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide |
|---|---|
| PubChem CID | 169018119 |
| Molecular Formula | C33H34ClN5O3 |
| Molecular Weight | 584.12 g/mol |
| Exact Mass | 583.24 |
| IUPAC Name | 5-[2-[4-[[3-chloro-4-[2-(hydroxymethyl)phenyl]phenyl]methylamino]butoxy]ethylamino]benzo[c][2,6]naphthyridine-8-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)nc(NCCOCCCCNCc1ccc(-c3ccccc3CO)c(Cl)c1)c1ccncc12 |
| InChI | InChI=1S/C33H34ClN5O3/c34-30-17-22(7-9-26(30)25-6-2-1-5-24(25)21-40)19-36-12-3-4-15-42-16-14-38-33-28-11-13-37-20-29(28)27-10-8-23(32(35)41)18-31(27)39-33/h1-2,5-11,13,17-18,20,36,40H,3-4,12,14-16,19,21H2,(H2,35,41)(H,38,39) |
| InChIKey | GNYQNJNQFYUQRV-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 122.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.12 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|